For research use only. Not for therapeutic Use.
1,3-Bis(isocyanatomethyl)benzene(Cat No.:L006996), is a diisocyanate compound used in polyurethane chemistry. It features two isocyanate (-NCO) groups attached to a benzene ring. This compound acts as a crosslinking agent and is employed in the production of polyurethane foams, coatings, and adhesives. Its reactivity enables the formation of strong, flexible polyurethane networks, making it valuable in various industrial applications. Researchers and manufacturers utilize 1,3-Bis(isocyanatomethyl)benzene to tailor the properties of polyurethane materials, ensuring their suitability for specific applications, including in automotive, construction, and insulation industries, contributing to the development of diverse polyurethane-based products.
CAS Number | 3634-83-1 |
Molecular Formula | C10H8N2O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1,3-bis(isocyanatomethyl)benzene |
InChI | InChI=1S/C10H8N2O2/c13-7-11-5-9-2-1-3-10(4-9)6-12-8-14/h1-4H,5-6H2 |
InChIKey | RTTZISZSHSCFRH-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)CN=C=O)CN=C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |