Home
>
Catalysts and Ligands>Chiral nitrogen ligands> 1,3-Bis((S)-4-isobutyl-4,5-dihydrooxazol-2-yl)benzene
For research use only. Not for therapeutic Use.
1,3-Bis((S)-4-isobutyl-4,5-dihydrooxazol-2-yl)benzene is a chiral, heterocyclic compound used in organic synthesis and pharmaceutical research. Featuring two dihydrooxazole groups attached to a benzene ring, it serves as a versatile ligand in asymmetric catalysis. The (S)-configuration of the isobutyl groups imparts chirality, making it particularly valuable for enantioselective reactions. This compound is often employed in the synthesis of complex molecules, including bioactive compounds, contributing to advancements in medicinal chemistry, drug development, and the creation of fine chemicals.
CAS Number | 265127-64-8 |
Molecular Formula | C20H28N2O2 |
Purity | ≥95% |
IUPAC Name | (4S)-4-(2-methylpropyl)-2-[3-[(4S)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C20H28N2O2/c1-13(2)8-17-11-23-19(21-17)15-6-5-7-16(10-15)20-22-18(12-24-20)9-14(3)4/h5-7,10,13-14,17-18H,8-9,11-12H2,1-4H3/t17-,18-/m0/s1 |
InChIKey | HDXFTNWCUVUHOS-ROUUACIJSA-N |