For research use only. Not for therapeutic Use.
1,3-Bis(tosyloxy)propane is a versatile organic compound featuring two tosylate groups attached to a propane backbone. The tosyl groups, derived from tosyl chloride, enhance the compound’s reactivity, making it an effective leaving group in nucleophilic substitution reactions. This structure allows for the easy formation of various derivatives, facilitating applications in organic synthesis. The compound can serve as a useful intermediate in the synthesis of more complex molecules, including pharmaceuticals and functional materials, due to its ability to participate in diverse chemical transformations.
CAS Number | 5469-66-9 |
Molecular Formula | C17H20O6S2 |
Purity | ≥95% |
IUPAC Name | 3-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate |
InChI | InChI=1S/C17H20O6S2/c1-14-4-8-16(9-5-14)24(18,19)22-12-3-13-23-25(20,21)17-10-6-15(2)7-11-17/h4-11H,3,12-13H2,1-2H3 |
InChIKey | ODVREDGIWSDQFD-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCOS(=O)(=O)C2=CC=C(C=C2)C |