For research use only. Not for therapeutic Use.
1,3-Di-tert-butyl-5-heptylbenzene(Cat No.:L025420)is an aromatic hydrocarbon compound characterized by two tert-butyl groups at the 1 and 3 positions and a heptyl chain at the 5-position on the benzene ring. This compound is used in organic synthesis and materials science, particularly in the development of specialized polymers, lubricants, and additives. Its bulky alkyl groups provide steric hindrance, enhancing the stability and performance of the resulting materials. 1,3-Di-tert-butyl-5-heptylbenzene is valuable for researchers working on advanced materials and chemical formulations.
CAS Number | 1643540-34-4 |
Molecular Formula | C21H36 |
Purity | ≥95% |
IUPAC Name | 1,3-ditert-butyl-5-heptylbenzene |
InChI | InChI=1S/C21H36/c1-8-9-10-11-12-13-17-14-18(20(2,3)4)16-19(15-17)21(5,6)7/h14-16H,8-13H2,1-7H3 |
InChIKey | DJFMWXBOTDQZNH-UHFFFAOYSA-N |
SMILES | CCCCCCCC1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C |