For research use only. Not for therapeutic Use.
1,3-Di-tert-butyl-5-iodobenzene(Cat No.:L010523)is a chemically modified benzene derivative characterized by its bulky tert-butyl groups and a reactive iodine atom. This structural configuration imparts enhanced steric hindrance and reactivity, making it an invaluable intermediate in the synthesis of advanced polymers and pharmaceutical compounds. The iodine atom is particularly useful for facilitating further functionalization through various organic reactions, including coupling reactions. This compound is instrumental in materials science and medicinal chemistry, aiding in the development of novel materials and therapeutic agents with optimized properties for specific applications.
CAS Number | 37055-53-1 |
Molecular Formula | C14H21I |
Purity | ≥95% |
IUPAC Name | 1,3-ditert-butyl-5-iodobenzene |
InChI | InChI=1S/C14H21I/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3 |
InChIKey | WHNJNYKUXPHIOO-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC(=C1)I)C(C)(C)C |