For research use only. Not for therapeutic Use.
1,3-Diaminopropane-N,N’-diacetic acid is a chelating agent with the formula C5H12N2O4. It consists of a 1,3-diaminopropane backbone, where two amine groups are substituted with acetic acid (-COOH) groups at the N-positions. This compound is a derivative of ethylenediamine and is used in coordination chemistry and analytical chemistry due to its ability to form stable complexes with metal ions. It may also have applications in the synthesis of biologically active compounds or as a ligand in metal ion sequestration.
Catalog Number | M030554 |
CAS Number | 112041-05-1 |
Molecular Formula | C7H14N2O4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-[3-(carboxymethylamino)propylamino]acetic acid |
InChI | InChI=1S/C7H14N2O4/c10-6(11)4-8-2-1-3-9-5-7(12)13/h8-9H,1-5H2,(H,10,11)(H,12,13) |
InChIKey | RKPHYUBLENEQNT-UHFFFAOYSA-N |
SMILES | C(CNCC(=O)O)CNCC(=O)O |