For research use only. Not for therapeutic Use.
1,3-Dibromo-5-iodo-2-methylbenzene (Cat.No:L003599) is a notable halogenated compound with diverse applications in organic synthesis. Its unique molecular structure, featuring a combination of bromine and iodine atoms, makes it a valuable building block for the preparation of specialized materials and pharmaceutical intermediates. This compound’s distinctive reactivity and versatility highlight its importance in the development of novel chemical entities
Catalog Number | L003599 |
CAS Number | 704909-84-2 |
Molecular Formula | C7H5Br2I |
Purity | ≥95% |
IUPAC Name | 1,3-dibromo-5-iodo-2-methylbenzene |
InChI | InChI=1S/C7H5Br2I/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,1H3 |
InChIKey | KPJDQGNISKKJTK-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1Br)I)Br |