For research use only. Not for therapeutic Use.
1,3-Dibromo-5-(trifluoromethoxy)benzene(Cat No.:L020508)is a high-purity aromatic compound widely used in pharmaceutical and chemical research. This molecule features a benzene ring substituted with bromine atoms at the 1 and 3 positions and a trifluoromethoxy group at the 5 position, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates and advanced materials. Its unique structure allows for selective reactivity in various chemical transformations. 1,3-Dibromo-5-(trifluoromethoxy)benzene is essential for precise synthetic applications in medicinal chemistry and innovative research.
CAS Number | 207226-31-1 |
Molecular Formula | C7H3Br2F3O |
Purity | ≥95% |
IUPAC Name | 1,3-dibromo-5-(trifluoromethoxy)benzene |
InChI | InChI=1S/C7H3Br2F3O/c8-4-1-5(9)3-6(2-4)13-7(10,11)12/h1-3H |
InChIKey | UKHOUWWEEAOCTI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1Br)Br)OC(F)(F)F |