For research use only. Not for therapeutic Use.
1,3-Dichloro-2-fluoro-5-iodobenzene(Cat No.:L033230)is a halogenated aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a benzene ring with chlorine atoms at the 1 and 3 positions, a fluorine atom at the 2 position, and an iodine atom at the 5 position. This combination of halogens provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, including pharmaceuticals and agrochemicals. The compound is particularly useful in cross-coupling reactions and other functionalization processes, essential for researchers focused on drug discovery and advanced materials development.
CAS Number | 133307-08-1 |
Molecular Formula | C6H2Cl2FI |
Purity | ≥95% |
IUPAC Name | 1,3-dichloro-2-fluoro-5-iodobenzene |
InChI | InChI=1S/C6H2Cl2FI/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
InChIKey | UCQPKKMSAOKIEA-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1Cl)F)Cl)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |