For research use only. Not for therapeutic Use.
1,3-Didodecyl-2-methyl-1H-imidazol-3-ium chloride is a quaternary ammonium compound featuring a 1H-imidazolium ring with two dodecyl chains at the 1 and 3 positions and a methyl group at the 2 position. This structure imparts unique surfactant properties, making it useful in various applications, including as a stabilizer in emulsions and as a phase transfer catalyst. The long hydrophobic dodecyl chains enhance its solubility in organic solvents, while the ionic chloride provides additional reactivity and versatility in chemical synthesis.
Catalog Number | L039743 |
CAS Number | 21054-71-7 |
Molecular Formula | C28H55ClN2 |
Purity | ≥95% |
IUPAC Name | 1,3-didodecyl-2-methylimidazol-1-ium;chloride |
InChI | InChI=1S/C28H55N2.ClH/c1-4-6-8-10-12-14-16-18-20-22-24-29-26-27-30(28(29)3)25-23-21-19-17-15-13-11-9-7-5-2;/h26-27H,4-25H2,1-3H3;1H/q+1;/p-1 |
InChIKey | ONVPFSYQVOTHPK-UHFFFAOYSA-M |
SMILES | CCCCCCCCCCCCN1C=C[N+](=C1C)CCCCCCCCCCCC.[Cl-] |