For research use only. Not for therapeutic Use.
1,3-Difluoro-2-(1-methylethoxy)benzene (Cat.No:L003583) is a significant chemical compound in modern organic synthesis. Its unique fluorinated structure, combined with the methylethoxy group, imparts distinct reactivity. This compound finds application as a versatile building block in the synthesis of specialized materials and pharmaceuticals. Its role in the creation of innovative compounds highlights its importance in contemporary chemical research, particularly in the development of advanced materials for various industries.
CAS Number | 1219020-68-4 |
Molecular Formula | C9H10F2O |
Purity | ≥95% |
IUPAC Name | 1,3-difluoro-2-propan-2-yloxybenzene |
InChI | InChI=1S/C9H10F2O/c1-6(2)12-9-7(10)4-3-5-8(9)11/h3-6H,1-2H3 |
InChIKey | HJIDDYWFPUAVPO-UHFFFAOYSA-N |
SMILES | CC(C)OC1=C(C=CC=C1F)F |