For research use only. Not for therapeutic Use.
1,3-Difluoro-5-(methylsulfanyl)benzene(Cat No.:L010262)is a fluorinated aromatic compound featuring two fluorine atoms and a methylsulfanyl group. This unique structure makes it a valuable intermediate in pharmaceutical and agrochemical synthesis. The presence of fluorine atoms enhances the compound’s reactivity and bioavailability, while the methylsulfanyl group provides opportunities for further functionalization. This compound is essential for the development of new chemical entities, particularly in designing inhibitors and drug candidates. Its high purity and consistent quality ensure reliable performance in advanced organic synthesis and medicinal chemistry research.
CAS Number | 54378-77-7 |
Molecular Formula | C7H6F2S |
Purity | ≥95% |
IUPAC Name | 1,3-difluoro-5-methylsulfanylbenzene |
InChI | InChI=1S/C7H6F2S/c1-10-7-3-5(8)2-6(9)4-7/h2-4H,1H3 |
InChIKey | FUXPOXBGHMSQSK-UHFFFAOYSA-N |
SMILES | CSC1=CC(=CC(=C1)F)F |