For research use only. Not for therapeutic Use.
1,3-Dihydroxyacetone (Cat.No:R024013) is a simple carbohydrate compound often used in self-tanning products and cosmetics due to its ability to react with amino acids in the outermost layer of the skin, resulting in a temporary tanned appearance. It’s a key ingredient in many sunless tanning products and is generally considered safe for topical use.
CAS Number | 96-26-4 |
Synonyms | Bis(hydroxymethyl) Ketone; Chromelin; Dihydroxyacetone; Dihyxal; NSC 24343; Otan; Oxantin; Oxatone; Soleal; Triulose; Viticolor; α,α’-Dihydroxyacetone; 2-Propanone, 1,3-Dihydroxy-1,3-dihydroxy-2-propanone; |
Molecular Formula | C3H6O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 1,3-dihydroxypropan-2-one |
InChI | InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2 |
InChIKey | RXKJFZQQPQGTFL-UHFFFAOYSA-N |
SMILES | C(C(=O)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |