For research use only. Not for therapeutic Use.
1,3-bis(1-methyl vinyl)benzene（Cat No.:I020730） is an organic intermediate that can be used to prepare supramolecular polymers and cross-linked modified polyvinyl chloride special resins.
| Catalog Number | I020730 |
| CAS Number | 3748-13-8 |
| Synonyms | 1,3-Diisopropenylbenzene |
| Molecular Formula | C12H14 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | 2-8°C |
| IUPAC Name | 1,3-Diisopropenylbenzene |
| InChI | InChI=1S/C12H14/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-8H,1,3H2,2,4H3 |
| InChIKey | IBVPVTPPYGGAEL-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC(C(C)=C)=CC=C1)C |
