For research use only. Not for therapeutic Use.
1,3-Dimethyl-2-phenylnaphthalene is a high-purity aromatic hydrocarbon used in organic synthesis and materials science. This compound is essential for studying aromatic substitution reactions and developing advanced materials such as organic semiconductors and light-emitting diodes. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, 1,3-Dimethyl-2-phenylnaphthalene enhances research accuracy and efficiency.
Catalog Number | R023174 |
CAS Number | 119264-82-3 |
Molecular Formula | C18H16 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3-dimethyl-2-phenylnaphthalene |
InChI | InChI=1S/C18H16/c1-13-12-16-10-6-7-11-17(16)14(2)18(13)15-8-4-3-5-9-15/h3-12H,1-2H3 |
InChIKey | LKYXFOBXGHLFDK-UHFFFAOYSA-N |
SMILES | CC1=CC2=CC=CC=C2C(=C1C3=CC=CC=C3)C |