For research use only. Not for therapeutic Use.
1,3-Dimethyl-8-phenylxanthine (Cat No.:C001106) is a xanthine derivative with two methyl groups and a phenyl group attached to the xanthine nucleus. As a non-selective adenosine receptor antagonist, it is widely used in scientific research to investigate the role of adenosine receptors in various physiological processes. Due to its pharmacological activity, it may have potential applications in drug development and medical research. Researchers utilize this compound as a tool to study the effects of adenosine receptors and their involvement in cellular signaling pathways.
| Catalog Number | C001106 |
| CAS Number | 961-45-5 |
| Synonyms | 3,7-Dihydro-1,3-dimethyl-8-phenyl-1H-purine-2,6-dione; 3,9-Dihydro-1,3-dimethyl-8-phenyl-1H-purine-2,6-dione; 8-Phenyl-theophylline; 3,7-Dihydro-1,3-dimethyl-8-phenyl-1H-purine-2,6-dione; 8-PT; 8-Phenyl-1,3-dimethylxanthine; 8-Phenyltheophylline; NSC 14127; |
| Molecular Formula | C₁₃H₁₂N₄O₂ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 1,3-dimethyl-8-phenyl-7H-purine-2,6-dione |
| InChI | InChI=1S/C13H12N4O2/c1-16-11-9(12(18)17(2)13(16)19)14-10(15-11)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,14,15) |
| InChIKey | PJFMAVHETLRJHJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)C3=CC=CC=C3 |
| Reference | Akula, K. K., et al.: Phytoth. Res., 28, 714-721 (2014) |
