For research use only. Not for therapeutic Use.
1,3-Dimethylimidazolium methylsulfate is an ionic liquid composed of a dimethylimidazolium cation and a methylsulfate anion. This compound is known for its low volatility, high thermal stability, and ionic nature, making it valuable in various chemical processes. It serves as a solvent and catalyst in organic synthesis, facilitating reactions such as alkylation and esterification. Additionally, its unique properties make it useful in electrochemistry and as a medium for biomass processing. This compound exemplifies the versatility of ionic liquids in green chemistry applications.
Catalog Number | L011891 |
CAS Number | 97345-90-9 |
Molecular Formula | C6H12N2O4S |
Purity | ≥95% |
IUPAC Name | 1,3-dimethylimidazol-1-ium;methyl sulfate |
InChI | InChI=1S/C5H9N2.CH4O4S/c1-6-3-4-7(2)5-6;1-5-6(2,3)4/h3-5H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
InChIKey | WOKQGMYCUGJNIJ-UHFFFAOYSA-M |
SMILES | CN1C=C[N+](=C1)C.COS(=O)(=O)[O-] |