For research use only. Not for therapeutic Use.
1,3-Dimethylpyrazole is a heterocyclic organic compound featuring a pyrazole ring with methyl groups at the 1 and 3 positions. This compound is commonly used in synthetic organic chemistry as a ligand in coordination chemistry, often forming metal complexes. Its unique structure allows it to participate in catalytic reactions, including hydrogenation and cross-coupling processes. Additionally, 1,3-dimethylpyrazole is explored for its potential biological activities and applications in the development of agrochemicals, pharmaceuticals, and materials science.
CAS Number | 694-48-4 |
Synonyms | 2,5-Dimethylpyrazole; NSC 190569; |
Molecular Formula | C5H8N2 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | Room temperature |
IUPAC Name | 1,3-dimethylpyrazole |
InChI | InChI=1S/C5H8N2/c1-5-3-4-7(2)6-5/h3-4H,1-2H3 |
InChIKey | NODLZCJDRXTSJO-UHFFFAOYSA-N |
SMILES | CC1=NN(C=C1)C |