For research use only. Not for therapeutic Use.
13-Hydroxytridecanoic acid(CAT: L000480) is a compound of interest in the field of organic chemistry, particularly as a key intermediate in the synthesis of various organic molecules. This compound finds applications in different fields, including the synthesis of lipids, surfactants, and other organic compounds used in various industries.
CAS Number | 7735-38-8 |
Molecular Formula | C13H26O3 |
Purity | ≥95% |
IUPAC Name | 13-hydroxytridecanoic acid |
InChI | InChI=1S/C13H26O3/c14-12-10-8-6-4-2-1-3-5-7-9-11-13(15)16/h14H,1-12H2,(H,15,16) |
InChIKey | DWXOPJCPYKBNEC-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |