For research use only, not for therapeutic use.
13,14-Dihydro-15-keto-PGE2-d9(Cat No.:S000842) is a deuterated form of 13,14-Dihydro-15-keto Prostaglandin E2, where nine hydrogen atoms are replaced with deuterium, giving it the molecular formula C20H23D9O5. This stable isotope-labeled compound is primarily used in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to study the metabolism and biological pathways of prostaglandins, which are important in inflammation and various physiological processes. The deuterated form provides enhanced detection and quantification, making it invaluable for research into inflammatory diseases, pain management, and the development of anti-inflammatory drugs.
Catalog Number | S000842 |
CAS Number | 2750534-81-5 |
Molecular Formula | C20H23D9O5 |
Purity | ≥95% |
IUPAC Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(5,5,6,6,7,7,8,8,8-nonadeuterio-3-oxooctyl)-5-oxocyclopentyl]hept-5-enoic acid |
InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,16-17,19,23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t16-,17-,19-/m1/s1/i1D3,2D2,3D2,6D2 |
InChIKey | CUJMXIQZWPZMNQ-QNUVVDNFSA-N |
SMILES | CCCCCC(=O)CCC1C(CC(=O)C1CC=CCCCC(=O)O)O |