For research use only. Not for therapeutic Use.
1,3,5-Benzenetricarbonitrile, 2,4,6-trimethyl-(Cat.No:L003639) is a significant chemical compound known for its unique aromatic properties. This trisubstituted benzenetricarbonitrile exhibits enhanced stability due to the presence of three methyl groups. It finds applications in various industries, including pharmaceuticals, electronics, and materials science.
Catalog Number | L003639 |
CAS Number | 1206-85-5 |
Molecular Formula | C12H9N3 |
Purity | ≥95% |
IUPAC Name | 2,4,6-trimethylbenzene-1,3,5-tricarbonitrile |
InChI | InChI=1S/C12H9N3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h1-3H3 |
InChIKey | WURVTDKUHZJPJX-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C(=C1C#N)C)C#N)C)C#N |