For research use only. Not for therapeutic Use.
1,3,5-Triaminobenzene trihydrochloride (Cat.No:M018765) is a chemical compound known for its aromatic structure with three amino groups. It has applications in organic synthesis, particularly in the production of dyes, pharmaceuticals, and coordination complexes. The trihydrochloride form enhances solubility, making it more convenient for various chemical reactions.
Catalog Number | M018765 |
CAS Number | 638-09-5 |
Synonyms | 1,3,5-TRIAMINOBENZENE TRICHLORIDE;1,3,5-TRIAMINOBENZENE TRIHYDROCHLORIDE;1,3,5-triaMine trihydrochloride;1,3,5-BenzenetriaMine, trihydrochloride;Benzene-1,3,5-triaMine trihydrochloride |
Molecular Formula | C6H12Cl3N3 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | benzene-1,3,5-triamine;trihydrochloride |
InChI | InChI=1S/C6H9N3.3ClH/c7-4-1-5(8)3-6(9)2-4;;;/h1-3H,7-9H2;3*1H |
InChIKey | GSPBVFMIOSWQJB-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1N)N)N.Cl.Cl.Cl |