For research use only. Not for therapeutic Use.
1,3,5-Trichloro-2-methylbenzene (Cat No.:C001074) is a chemical compound with three chlorine atoms and one methyl group attached to a benzene ring. It is a colorless liquid and is mainly used as an intermediate in the synthesis of various organic compounds. This compound’s unique substitution pattern makes it of interest in chemical research and pharmaceutical synthesis, where it serves as a starting material for the preparation of diverse derivatives.
| Catalog Number | C001074 |
| CAS Number | 23749-65-7 |
| Synonyms | 2,4,6-Trichlorotoluene; 2,4,6-Trichloro-toluene; |
| Molecular Formula | C₇H₅Cl₃ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Hexanes (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Low-Melting Solid |
| Storage | 4°C |
| IUPAC Name | 1,3,5-trichloro-2-methylbenzene |
| InChI | InChI=1S/C7H5Cl3/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3 |
| InChIKey | RCTKUIOMKBEGTG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)Cl)Cl |
| Reference | Eichinger, W., et al.: PCT Int. Appl., WO 2001017932 A1 20010315 (2001); Stella, T., et al.: Sci Total Environ, 533, 177-186 (2015) |
