For research use only. Not for therapeutic Use.
1,3,5-Trihydroxyhexahydro-1,3,5-triazine-2,4,6-trione (Cat.No:M092645) is a chemical compound with potential pharmaceutical and chemical applications. It contains a hexahydrotriazine ring structure with multiple hydroxyl groups. CAS 143435-52-3 may serve as a valuable intermediate in the synthesis of various organic compounds and is of interest in medicinal chemistry research.
CAS Number | 143435-52-3 |
Synonyms | 1,3,5-Trihydroxyhexahydro-1,3,5-triazine-2,4,6-trione |
Molecular Formula | C3H3N3O6 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,3,5-trihydroxy-1,3,5-triazinane-2,4,6-trione |
InChI | InChI=1S/C3H3N3O6/c7-1-4(10)2(8)6(12)3(9)5(1)11/h10-12H |
InChIKey | NBIJDQIBCRZHFK-UHFFFAOYSA-N |
SMILES | C1(=O)N(C(=O)N(C(=O)N1O)O)O |