For research use only. Not for therapeutic Use.
1,3,5-Tris(p-formylphenyl)benzene(Cat No.:M027862) is a multifunctional organic molecule structured with a central benzene ring symmetrically substituted with three p-formylphenyl groups. This compound is characterized by its three aldehyde groups, which are reactive and can facilitate further chemical transformations, making it a useful building block in organic synthesis. The symmetrical and rigid architecture of this compound is particularly valuable in materials science, especially for constructing porous materials, polymers, and small molecule-based frameworks. These applications often exploit its ability to form extended networks through reactions at the formyl groups, leading to materials with unique properties.
CAS Number | 118688-53-2 |
Molecular Formula | C27H18O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[3,5-bis(4-formylphenyl)phenyl]benzaldehyde |
InChI | InChI=1S/C27H18O3/c28-16-19-1-7-22(8-2-19)25-13-26(23-9-3-20(17-29)4-10-23)15-27(14-25)24-11-5-21(18-30)6-12-24/h1-18H |
InChIKey | ZCJZVMNBJKPQEV-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)C2=CC(=CC(=C2)C3=CC=C(C=C3)C=O)C4=CC=C(C=C4)C=O |