For research use only. Not for therapeutic Use.
1,3,5-Tris(bromoethynyl)benzene (Cat.No:L003749) is a significant chemical compound in materials science. Its unique structure, featuring three bromoethynyl groups, imparts exceptional reactivity. This compound serves as a crucial building block in the synthesis of specialized materials, particularly in the field of organic electronics. Its versatile nature makes it indispensable in the development of innovative materials for various applications, highlighting its importance in contemporary chemical research and its role in advancing technology.
Catalog Number | L003749 |
CAS Number | 177738-26-0 |
Molecular Formula | C12H3Br3 |
Purity | ≥95% |
IUPAC Name | 1,3,5-tris(2-bromoethynyl)benzene |
InChI | InChI=1S/C12H3Br3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h7-9H |
InChIKey | ZXTCMOSJRYMPCU-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C#CBr)C#CBr)C#CBr |