For research use only. Not for therapeutic Use.
1,3,5,7-Tetraaminoadamantane (Cat.No:L003867) is a pivotal chemical compound with versatile applications. Its unique adamantane framework, bearing four amino groups, imparts distinctive reactivity and properties. This compound serves as a crucial building block in the synthesis of specialized molecules, including pharmaceutical agents and advanced materials.
CAS Number | 16004-77-6 |
Molecular Formula | C10H20N4 |
Purity | ≥95% |
IUPAC Name | adamantane-1,3,5,7-tetramine |
InChI | InChI=1S/C10H20N4/c11-7-1-8(12)4-9(13,2-7)6-10(14,3-7)5-8/h1-6,11-14H2 |
InChIKey | MVWWMAVSZMEULL-UHFFFAOYSA-N |
SMILES | C1C2(CC3(CC1(CC(C2)(C3)N)N)N)N |