For research use only. Not for therapeutic Use.
1,3,5,7-Tetrakis(4-ethynylphenyl)adamantane (Cat.No:L003767) is a pivotal compound in materials science. Its unique adamantane core and ethynylphenyl substituents bestow distinctive properties. This compound serves as a crucial building block for the creation of specialized materials with applications in electronics and optoelectronics.
Catalog Number | L003767 |
CAS Number | 144970-32-1 |
Molecular Formula | C42H32 |
Purity | ≥95% |
IUPAC Name | 1,3,5,7-tetrakis(4-ethynylphenyl)adamantane |
InChI | InChI=1S/C42H32/c1-5-31-9-17-35(18-10-31)39-25-40(36-19-11-32(6-2)12-20-36)28-41(26-39,37-21-13-33(7-3)14-22-37)30-42(27-39,29-40)38-23-15-34(8-4)16-24-38/h1-4,9-24H,25-30H2 |
InChIKey | WAKHBSLAUKOVSZ-UHFFFAOYSA-N |
SMILES | C#CC1=CC=C(C=C1)C23CC4(CC(C2)(CC(C3)(C4)C5=CC=C(C=C5)C#C)C6=CC=C(C=C6)C#C)C7=CC=C(C=C7)C#C |