For research use only. Not for therapeutic Use.
1,3,6-Tri-O-galloyl-β-D-glucose(Cat No.:M087987)is a high-purity polyphenolic compound widely used in biochemical and pharmaceutical research. It is known for its potent antioxidant, anti-inflammatory, and antimicrobial properties. This compound is crucial for studying cellular protection mechanisms against oxidative stress and inflammation. Additionally, it is used in developing novel therapeutic agents for diseases such as cancer, diabetes, and cardiovascular disorders. Its precise activity and bioavailability make it an essential tool in natural product research and drug discovery, contributing to the advancement of medical and health sciences.
CAS Number | 18483-17-5 |
Molecular Formula | C27H24O18 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | Store at -20C |
IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-dihydroxy-4,6-bis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
InChI | InChI=1S/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-21(37)23(44-25(40)9-3-13(30)19(35)14(31)4-9)22(38)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2/t17-,21-,22-,23+,27+/m1/s1 |
InChIKey | RNKMOGIPOMVCHO-SJMVAQJGSA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O |