For research use only. Not for therapeutic Use.
1,3,7-<wbr></wbr>Trimethyluric acid is a methyl derivative of uric acid (Item No. <span class=/itemid/>16219</span>) and a product of C-<wbr></wbr>8 oxidation of caffeine (Item No. <span class=/itemid/>14118</span>) by cytochrome P450 enzymes. It can be detected in urine as a marker of caffeine consumption.
| Catalog Number | R014773 |
| CAS Number | 5415-44-1 |
| Synonyms | Ba 2753; NSC 11259; NSC 95858; 1,3,7-Trimethyl Uric Acid; 7,9-Dihydro-1,3,7-trimethyl-1H-Purine-2,6,8(3H)-trione; |
| Molecular Formula | C8H10N4O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 1,3,7-trimethyl-9H-purine-2,6,8-trione |
| InChI | InChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h1-3H3,(H,9,14) |
| InChIKey | BYXCFUMGEBZDDI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC1=O)N(C(=O)N(C2=O)C)C |
