Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds>
>
13C6-3-Nitrophenylhydrazine (hydrochloride)
13C6-3-Nitrophenylhydrazine (hydrochloride) is a labeled form of 3-nitrophenylhydrazine, where six carbon atoms in the molecule are replaced with the carbon-13 isotope. This isotopic labeling is particularly valuable in analytical and research applications, such as mass spectrometry and NMR spectroscopy, enabling precise tracking and analysis of the compound. The hydrochloride salt form increases the compound’s solubility and stability, making it more suitable for laboratory use. This compound is commonly used in the derivatization of carbonyl compounds, facilitating their detection and quantification in various chemical and biological studies. The 13C labeling aids in detailed mechanistic and metabolic studies by providing a distinct isotopic signature.
Catalog Number | R066839 |
CAS Number | 1977535-33-3 |
Synonyms | 13C6-3-NPH |
Molecular Formula | [13C]6H7N3O2 |
Purity | 95% |
Storage | -20°C |
InChI | InChI=1S/C6H7N3O2.ClH/c7-8-5-2-1-3-6(4-5)9(10)11;/h1-4,8H,7H2;1H/i1+1,2+1,3+1,4+1,5+1,6+1; |
InChIKey | BKOYKMLGFFASBG-BVNCJLROSA-N |
SMILES | NN[13C]1=[13CH][13CH]=[13CH][13C]([N+]([O-])=O)=[13CH]1.Cl |