For research use only. Not for therapeutic Use.
1,4-Anhydroerythritol (Cat.No:R057889) is a sugar alcohol derivative with potential applications in various fields. It is derived from erythritol and features a cyclic structure due to the loss of a water molecule. 1,4-Anhydroerythritol has been investigated for its potential as a precursor in the synthesis of bioactive compounds and polymers.
Catalog Number | R057889 |
CAS Number | 4358-64-9 |
Synonyms | (3R,4S)-Tetrahydrofuran-3,4-diol; (3S,4R)-Tetrahydrofuran-3,4-diol; Erythritan; Erythritol-1,4-anhydride; cis-3,4-Dihydroxyoxolane; cis-3,4-Dihydroxytetrahydrofuran; cis-Oxolane-3,4-diol; cis-Tetrahydrofuran-3,4-diol; meso-3,4-Dihydroxytetrahydrofura |
Molecular Formula | C4H8O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (3S,4R)-oxolane-3,4-diol |
InChI | InChI=1S/C4H8O3/c5-3-1-7-2-4(3)6/h3-6H,1-2H2/t3-,4+ |
InChIKey | SSYDTHANSGMJTP-ZXZARUISSA-N |
SMILES | C1C(C(CO1)O)O |