For research use only. Not for therapeutic Use.
14-Azido-3,6,9,12-tetraoxatetradecanol(CAT: R029406) is a chemical compound with an intricate molecular structure. It falls under the category of azido compounds, which contain the azido functional group (-N3). This specific compound consists of a long hydrocarbon chain with four oxygen atoms and one azido group. Azido compounds are known for their diverse applications in organic synthesis and chemical research, particularly in the development of pharmaceuticals and materials science.
Catalog Number | R029406 |
CAS Number | 86770-68-5 |
Synonyms | 14-Azido-3,6,9,12-tetraoxatetradecan-1-ol |
Molecular Formula | C10H21N3O5 |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanol |
InChI | InChI=1S/C10H21N3O5/c11-13-12-1-3-15-5-7-17-9-10-18-8-6-16-4-2-14/h14H,1-10H2 |
InChIKey | JTGGTGKXQQGEHB-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCOCCO)N=[N+]=[N-] |