For research use only. Not for therapeutic Use.
1,4-Benzenedicarboxaldehyde, 2,5-bis(dodecyloxy)- (Cat.No:L003834) is a crucial compound in materials science. Its distinctive structure, featuring dodecyloxy substituents, imparts specialized properties. This compound is employed in the synthesis of tailored polymers and liquid crystals, with applications in electronic devices. Its versatile nature and unique attributes make it a key component in the development of advanced materials for various industries, underscoring its significance in contemporary chemical research.
Catalog Number | L003834 |
CAS Number | 123415-45-2 |
Molecular Formula | C32H54O4 |
Purity | ≥95% |
IUPAC Name | 2,5-didodecoxyterephthalaldehyde |
InChI | InChI=1S/C32H54O4/c1-3-5-7-9-11-13-15-17-19-21-23-35-31-25-30(28-34)32(26-29(31)27-33)36-24-22-20-18-16-14-12-10-8-6-4-2/h25-28H,3-24H2,1-2H3 |
InChIKey | SOQFDIIEMNDHHN-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCOC1=CC(=C(C=C1C=O)OCCCCCCCCCCCC)C=O |