For research use only. Not for therapeutic Use.
1,4-Benzenedimethanethiol (Cat.No:M067186) is a chemical compound with a thiol group (-SH) attached to a benzene ring. It finds applications in organic synthesis, particularly in the modification of surfaces and materials due to its ability to form self-assembled monolayers. This compound is utilized in various fields, including nanotechnology and sensor development.
CAS Number | 105-09-9 |
Molecular Formula | C8H10S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [4-(sulfanylmethyl)phenyl]methanethiol |
InChI | InChI=1S/C8H10S2/c9-5-7-1-2-8(6-10)4-3-7/h1-4,9-10H,5-6H2 |
InChIKey | IYPNRTQAOXLCQW-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CS)CS |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |