For research use only. Not for therapeutic Use.
1,4-Bis(pyrid-4-yl)benzene is an organic compound characterized by a central benzene ring with two pyridine groups attached at the 1 and 4 positions. Its chemical formula is C₁₁H₈N₂. This compound is of interest in coordination chemistry and materials science due to its ability to form metal complexes and its potential applications in organic electronics and sensors. The pyridine groups enhance its reactivity and solubility, making it a valuable building block for the synthesis of novel compounds in various fields of research.
CAS Number | 113682-56-7 |
Molecular Formula | C16H12N2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 4-(4-pyridin-4-ylphenyl)pyridine |
InChI | InChI=1S/C16H12N2/c1-2-14(16-7-11-18-12-8-16)4-3-13(1)15-5-9-17-10-6-15/h1-12H |
InChIKey | MAWKLXRVKVOYLR-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=NC=C2)C3=CC=NC=C3 |