For research use only. Not for therapeutic Use.
1,4-Cubanedicarboxylic acid(Cat No.:M011283) is a derivative of cubane, a hydrocarbon with a highly strained, cube-shaped molecular structure. This particular compound modifies the cubane core by incorporating carboxylic acid groups at the 1 and 4 positions. The presence of these functional groups introduces new chemical reactivity and solubility characteristics, making it potentially useful for various synthetic applications. Due to the unique cubic structure and high strain energy of cubane derivatives, they are of interest in materials science for creating novel polymers and in pharmaceuticals for designing drugs with unique molecular architectures.
CAS Number | 32846-66-5 |
Synonyms | 1,4-CUBANEDICARBOXYLIC ACID;Cubane-1,4-dicarboxylic acid;Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylic acid |
Molecular Formula | C10H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | cubane-1,4-dicarboxylic acid |
InChI | InChI=1S/C10H8O4/c11-7(12)9-1-2-4(9)6-5(9)3(1)10(2,6)8(13)14/h1-6H,(H,11,12)(H,13,14) |
InChIKey | JFKXMJUMOJJTCQ-UHFFFAOYSA-N |
SMILES | C12C3C4C1(C5C2C3(C45)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |