For research use only. Not for therapeutic Use.
1,4-Dibromo-2,3-butanediol (Cat No.:M059546) is a chemical compound. It features a butanediol backbone with two bromine atoms attached at positions 1 and 4. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Dibromo-butanediols like this are often used as precursors for the synthesis of biologically active compounds, such as chiral building blocks. The presence of bromine atoms and the butanediol structure contribute to its reactivity and potential applications in the synthesis of pharmaceuticals and other valuable compounds, supporting scientific exploration and innovation.
CAS Number | 14396-65-7 |
Molecular Formula | C4H8Br2O2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1,4-dibromobutane-2,3-diol |
InChI | InChI=1S/C4H8Br2O2/c5-1-3(7)4(8)2-6/h3-4,7-8H,1-2H2 |
InChIKey | XOWDQAHYPSENAC-UHFFFAOYSA-N |
SMILES | C(C(C(CBr)O)O)Br |