For research use only. Not for therapeutic Use.
1,4-Dichlorophthalazine is a chemical compound belonging to the class of chlorinated heterocyclic compounds, specifically a derivative of phthalazine. It is characterized by the presence of two chlorine atoms substituted at positions 1 and 4 of the phthalazine ring. This compound is often used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its reactive nature. Its structure enables it to participate in various chemical reactions, making it valuable in organic chemistry and industrial applications.
CAS Number | 4752-10-7 |
Molecular Formula | C8H4Cl2N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,4-dichlorophthalazine |
InChI | InChI=1S/C8H4Cl2N2/c9-7-5-3-1-2-4-6(5)8(10)12-11-7/h1-4H |
InChIKey | ODCNAEMHGMYADO-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=NN=C2Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |