For research use only. Not for therapeutic Use.
1,4-Diethoxynaphthalene (CAT: L000249) is an important compound primarily used in organic chemistry. It serves as a valuable reagent for the synthesis of various organic molecules. In organic chemistry, it is utilized as a building block for the creation of complex organic structures.
CAS Number | 27294-37-7 |
Molecular Formula | C14H16O2 |
Purity | ≥95% |
IUPAC Name | 1,4-diethoxynaphthalene |
InChI | InChI=1S/C14H16O2/c1-3-15-13-9-10-14(16-4-2)12-8-6-5-7-11(12)13/h5-10H,3-4H2,1-2H3 |
InChIKey | LJSLYKNKVQMIJY-UHFFFAOYSA-N |