For research use only. Not for therapeutic Use.
1,4-dihydronicotinamide riboside (Cat No.:M129611) is a derivative of nicotinamide riboside (NR), a form of vitamin B3. 1,4-DHN is an intermediate in the biosynthesis of NAD+ (nicotinamide adenine dinucleotide), a crucial molecule involved in cellular energy production and metabolism. Research suggests that 1,4-DHN may have therapeutic potential in metabolic disorders, neurodegenerative diseases, and aging-related conditions by boosting NAD+ levels. Additionally, 1,4-DHN has been studied for its antioxidant properties and its ability to modulate cellular pathways associated with inflammation and stress response.
CAS Number | 19132-12-8 |
Synonyms | 1,4-dihydronicotinaMide riboside |
Molecular Formula | C11H16N2O5 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxamide |
InChI | InChI=1S/C11H16N2O5/c12-10(17)6-2-1-3-13(4-6)11-9(16)8(15)7(5-14)18-11/h1,3-4,7-9,11,14-16H,2,5H2,(H2,12,17)/t7-,8-,9-,11-/m1/s1 |
InChIKey | MAKBMGXNXXXBFE-TURQNECASA-N |
SMILES | C1C=CN(C=C1C(=O)N)C2C(C(C(O2)CO)O)O |