For research use only. Not for therapeutic Use.
1,4-Dihydroxy-2-butanone(Cat No.:M068421), commonly known as DHB, is a chemical compound with a molecular structure consisting of a butanone backbone with hydroxyl groups attached at the 1st and 4th positions. Also referred to as ribose, it serves as a crucial component in the matrix-assisted laser desorption/ionization (MALDI) process, aiding in the ionization of analytes during mass spectrometry. DHB’s ability to efficiently absorb laser energy and transfer it to analytes makes it a widely used matrix in MALDI mass spectrometry for the analysis of peptides, proteins, carbohydrates, and other biomolecules in various research fields, including proteomics and metabolomics.
CAS Number | 140-86-3 |
Molecular Formula | C4H8O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,4-dihydroxybutan-2-one |
InChI | InChI=1S/C4H8O3/c5-2-1-4(7)3-6/h5-6H,1-3H2 |
InChIKey | XBJODPUPYBBDEM-UHFFFAOYSA-N |
SMILES | C(CO)C(=O)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |