For research use only. Not for therapeutic Use.
1,4-Diisopropylbenzene is an aromatic hydrocarbon used as an intermediate in the production of polymers, resins, and various chemical compounds. Known for its stability and reactivity, it is essential in manufacturing antioxidants, lubricants, and specialty chemicals. This compound is also utilized in research and industrial processes, contributing to the development of advanced materials and enhancing product performance.
Catalog Number | R025279 |
CAS Number | 100-18-5 |
Synonyms | 1,4-Bis(1-methylethyl)benzene; 1,4-Bis(isopropyl)benzene; NSC 84198; p-Di-iso-propylbenzene; p-Diisopropylbenzene |
Molecular Formula | C12H18 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,4-di(propan-2-yl)benzene |
InChI | InChI=1S/C12H18/c1-9(2)11-5-7-12(8-6-11)10(3)4/h5-10H,1-4H3 |
InChIKey | SPPWGCYEYAMHDT-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC=C(C=C1)C(C)C |