For research use only. Not for therapeutic Use.
1,4-Dimethylpyridinium iodide(CAT: L000113) is a significant compound with applications in organic and material chemistry. It is commonly employed in the synthesis of organic salts and as a source of pyridinium cations. These salts have a wide range of applications, including their use in ionic liquids, phase-transfer catalysts, and the preparation of various chemical compounds.
| Catalog Number | L000113 |
| CAS Number | 2301-80-6 |
| Molecular Formula | C7H10IN |
| Purity | ≥95% |
| IUPAC Name | 1,4-dimethylpyridin-1-ium;iodide |
| InChI | InChI=1S/C7H10N.HI/c1-7-3-5-8(2)6-4-7;/h3-6H,1-2H3;1H/q+1;/p-1 |
| InChIKey | YOBTXORLVXZWSR-UHFFFAOYSA-M |
