For research use only. Not for therapeutic Use.
1,4-Dioxane, 2,5-dimethyl-(Cat No.:M054421), also known as 2,5-dimethyl-1,4-dioxane, is a chemical derivative of 1,4-dioxane with two methyl groups added to the basic ring structure. This compound is a clear, colorless liquid, commonly used as a solvent in various industrial applications due to its ability to dissolve a wide range of organic substances. It’s particularly valued in the chemical and pharmaceutical industries for its stability and non-reactivity.
Catalog Number | M054421 |
CAS Number | 15176-21-3 |
Synonyms | 1,4-DIOXANE,2,5-DIMETHYL- |
Molecular Formula | C6H12O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2,5-dimethyl-1,4-dioxane |
InChI | InChI=1S/C6H12O2/c1-5-3-8-6(2)4-7-5/h5-6H,3-4H2,1-2H3 |
InChIKey | AWBIJARKDOFDAN-UHFFFAOYSA-N |
SMILES | CC1COC(CO1)C |