For research use only. Not for therapeutic Use.
1,4-Dioxo-3,6-diphenylpyrrolo[3,4-c]pyrrole(Cat No.:L036094)is a specialized heterocyclic compound widely used in materials science and organic chemistry. Known for its highly conjugated structure with two phenyl groups and a dioxopyrrolo core, this compound is a key intermediate in the synthesis of organic pigments and semiconductors. Its unique electronic properties make it valuable in the development of advanced materials, including organic photovoltaics and electronic devices. 1,4-Dioxo-3,6-diphenylpyrrolo[3,4-c]pyrrole supports innovative research in optoelectronics and high-performance material applications.
CAS Number | 54660-00-3 |
Molecular Formula | C18H10N2O2 |
Purity | ≥95% |
IUPAC Name | 3-hydroxy-1,4-diphenyl-2H-pyrrolo[3,4-c]pyrrol-6-one |
InChI | InChI=1S/C18H12N2O2/c21-17-13-14(16(20-17)12-9-5-2-6-10-12)18(22)19-15(13)11-7-3-1-4-8-11/h1-10,19,22H |
InChIKey | KKLJFKIBTOBVJI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C3C(=C(N2)O)C(=NC3=O)C4=CC=CC=C4 |