For research use only. Not for therapeutic Use.
1,4-Dipiperazino-2,3,5,6-tetrafluorobenzene(Cat No.:L026186)is a fluorinated aromatic compound featuring two piperazine rings attached to a tetrafluorobenzene core. This unique structure makes it a valuable intermediate in pharmaceutical research, particularly for developing advanced drugs targeting neurological disorders and cancer. The high fluorine content enhances the compound’s metabolic stability and bioavailability, making it an essential building block in the synthesis of potent therapeutic agents. Its consistent quality and versatility make it an indispensable tool for researchers in medicinal chemistry and drug development.
Catalog Number | L026186 |
CAS Number | 502616-02-6 |
Molecular Formula | C14H18F4N4 |
Purity | ≥95% |
IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine |
InChI | InChI=1S/C14H18F4N4/c15-9-11(17)14(22-7-3-20-4-8-22)12(18)10(16)13(9)21-5-1-19-2-6-21/h19-20H,1-8H2 |
InChIKey | LRTCJFIHCNYPQX-UHFFFAOYSA-N |
SMILES | C1CN(CCN1)C2=C(C(=C(C(=C2F)F)N3CCNCC3)F)F |