For research use only. Not for therapeutic Use.
1,4-Di(propynyl)benzene(Cat No.:L002948)is an aromatic compound featuring two propynyl groups attached to a benzene ring at the 1 and 4 positions. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of polymers, advanced materials, and pharmaceuticals. Its symmetrical structure and the presence of alkyne groups provide valuable reactivity, allowing for further functionalization and complex molecule construction. 1,4-Di(propynyl)benzene is essential for researchers and chemists working on innovative materials and the synthesis of novel bioactive compounds.
CAS Number | 105058-42-2 |
Molecular Formula | C12H10 |
Purity | ≥95% |
IUPAC Name | 1,4-bis(prop-1-ynyl)benzene |
InChI | InChI=1S/C12H10/c1-3-5-11-7-9-12(6-4-2)10-8-11/h7-10H,1-2H3 |
InChIKey | JQERGZDDUGLLIS-UHFFFAOYSA-N |
SMILES | CC#CC1=CC=C(C=C1)C#CC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |