For research use only. Not for therapeutic Use.
1,4-Hexanediol(Cat No.:M075502) is a colorless, viscous liquid alcohol consisting of a six-carbon chain with hydroxyl groups attached at the first and fourth carbon positions. It is commonly used as a versatile chemical intermediate in various industrial applications, including the synthesis of polymers, coatings, and adhesives. Its bifunctional nature allows it to undergo reactions such as esterification, etherification, and condensation, enabling the production of diverse compounds. Additionally, 1,4-hexanediol serves as a solvent, humectant, and coupling agent in formulations for cosmetics, personal care products, and pharmaceuticals, contributing to their stability and performance properties.
CAS Number | 16432-53-4 |
Molecular Formula | C6H14O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | hexane-1,4-diol |
InChI | InChI=1S/C6H14O2/c1-2-6(8)4-3-5-7/h6-8H,2-5H2,1H3 |
InChIKey | QVTWBMUAJHVAIJ-UHFFFAOYSA-N |
SMILES | CCC(CCCO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |