For research use only. Not for therapeutic Use.
1,4-Naphthalenediol (Cat.No:R069029) is a chemical compound used in various applications, including as a dye intermediate, antioxidant, and photoinitiator. Its aromatic structure lends itself to use in organic synthesis and polymer chemistry. Additionally, it has been studied for its potential antimicrobial and anticancer properties, contributing to its diverse range of uses.
CAS Number | 571-60-8 |
Synonyms | 1.4-Dihydroxynapthalene |
Molecular Formula | C10H8O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | naphthalene-1,4-diol |
InChI | InChI=1S/C10H8O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,11-12H |
InChIKey | PCILLCXFKWDRMK-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CC=C2O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |